C10H18N4O — CID 79579132
N-[2-[(1,5-dimethylpyrazol-4-yl)methylamino]ethyl]acetamide (PubChem CID 79579132) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N-[2-[(1,5-dimethylpyrazol-4-yl)methylamino]ethyl]acetamide.
| Compound Name | N-[2-[(1,5-dimethylpyrazol-4-yl)methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 79579132 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-[2-[(1,5-dimethylpyrazol-4-yl)methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1cnn(C)c1C |
| InChI | InChI=1S/C10H18N4O/c1-8-10(7-13-14(8)3)6-11-4-5-12-9(2)15/h7,11H,4-6H2,1-3H3,(H,12,15) |
| InChIKey | OXSAYFWEJMREIZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|