C12H23N3O — CID 115768038
6-[(1,5-dimethylpyrazol-4-yl)methylamino]hexan-3-ol (PubChem CID 115768038) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 6-[(1,5-dimethylpyrazol-4-yl)methylamino]hexan-3-ol.
| Compound Name | 6-[(1,5-dimethylpyrazol-4-yl)methylamino]hexan-3-ol |
|---|---|
| PubChem CID | 115768038 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 6-[(1,5-dimethylpyrazol-4-yl)methylamino]hexan-3-ol |
| SMILES | CCC(O)CCCNCc1cnn(C)c1C |
| InChI | InChI=1S/C12H23N3O/c1-4-12(16)6-5-7-13-8-11-9-14-15(3)10(11)2/h9,12-13,16H,4-8H2,1-3H3 |
| InChIKey | VXOBPLGOABIJCP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|