C12H21N3 — CID 115767982
3-cyclopropyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]propan-1-amine (PubChem CID 115767982) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-cyclopropyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]propan-1-amine.
| Compound Name | 3-cyclopropyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115767982 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 3-cyclopropyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]propan-1-amine |
| SMILES | Cc1c(CNCCCC2CC2)cnn1C |
| InChI | InChI=1S/C12H21N3/c1-10-12(9-14-15(10)2)8-13-7-3-4-11-5-6-11/h9,11,13H,3-8H2,1-2H3 |
| InChIKey | BJTUNFVJQBNXJR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|