C12H22N4O — CID 79578789
N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-morpholin-4-ylethanamine (PubChem CID 79578789) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 79578789 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-morpholin-4-ylethanamine |
| SMILES | Cc1c(CNCCN2CCOCC2)cnn1C |
| InChI | InChI=1S/C12H22N4O/c1-11-12(10-14-15(11)2)9-13-3-4-16-5-7-17-8-6-16/h10,13H,3-9H2,1-2H3 |
| InChIKey | IEVXYVNHOHNEIM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|