C11H21N5O — CID 43524751
N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-morpholin-4-ylethanamine (PubChem CID 43524751) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 43524751 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-morpholin-4-ylethanamine |
| SMILES | Cc1nnc(CNCCN2CCOCC2)n1C |
| InChI | InChI=1S/C11H21N5O/c1-10-13-14-11(15(10)2)9-12-3-4-16-5-7-17-8-6-16/h12H,3-9H2,1-2H3 |
| InChIKey | JHDXDYWQCBQURB-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|