C8H16N4S — CID 63966644
N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methylsulfanylethanamine (PubChem CID 63966644) has the molecular formula C8H16N4S and a molecular weight of 200.31 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methylsulfanylethanamine.
| Compound Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 63966644 |
| Molecular Formula | C8H16N4S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methylsulfanylethanamine |
| SMILES | CSCCNCc1nnc(C)n1C |
| InChI | InChI=1S/C8H16N4S/c1-7-10-11-8(12(7)2)6-9-4-5-13-3/h9H,4-6H2,1-3H3 |
| InChIKey | JIBXQLCIKGAUAO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|