C12H24N4S — CID 114125708
N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6-methylsulfanylhexan-1-amine (PubChem CID 114125708) has the molecular formula C12H24N4S and a molecular weight of 256.42 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6-methylsulfanylhexan-1-amine.
| Compound Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6-methylsulfanylhexan-1-amine |
|---|---|
| PubChem CID | 114125708 |
| Molecular Formula | C12H24N4S |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-6-methylsulfanylhexan-1-amine |
| SMILES | CSCCCCCCNCc1nnc(C)n1C |
| InChI | InChI=1S/C12H24N4S/c1-11-14-15-12(16(11)2)10-13-8-6-4-5-7-9-17-3/h13H,4-10H2,1-3H3 |
| InChIKey | YFDHYCRAHLPORB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|