C12H22N4O — CID 46784360
N-[(1-ethylimidazol-2-yl)methyl]-2-morpholin-4-ylethanamine (PubChem CID 46784360) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is N-[(1-ethylimidazol-2-yl)methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[(1-ethylimidazol-2-yl)methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 46784360 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | N-[(1-ethylimidazol-2-yl)methyl]-2-morpholin-4-ylethanamine |
| SMILES | CCn1ccnc1CNCCN1CCOCC1 |
| InChI | InChI=1S/C12H22N4O/c1-2-16-6-4-14-12(16)11-13-3-5-15-7-9-17-10-8-15/h4,6,13H,2-3,5,7-11H2,1H3 |
| InChIKey | VTBJVJWBJNVSFC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|