C16H26N2O — CID 43220541
2-morpholin-4-yl-N-[(2,4,5-trimethylphenyl)methyl]ethanamine (PubChem CID 43220541) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-[(2,4,5-trimethylphenyl)methyl]ethanamine.
| Compound Name | 2-morpholin-4-yl-N-[(2,4,5-trimethylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43220541 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2-morpholin-4-yl-N-[(2,4,5-trimethylphenyl)methyl]ethanamine |
| SMILES | Cc1cc(C)c(CNCCN2CCOCC2)cc1C |
| InChI | InChI=1S/C16H26N2O/c1-13-10-15(3)16(11-14(13)2)12-17-4-5-18-6-8-19-9-7-18/h10-11,17H,4-9,12H2,1-3H3 |
| InChIKey | OKFCEUHAKUICMB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|