C13H18F2N2O — CID 43312645
N-[(2,5-difluorophenyl)methyl]-2-morpholin-4-ylethanamine (PubChem CID 43312645) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 43312645 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-2-morpholin-4-ylethanamine |
| SMILES | Fc1ccc(F)c(CNCCN2CCOCC2)c1 |
| InChI | InChI=1S/C13H18F2N2O/c14-12-1-2-13(15)11(9-12)10-16-3-4-17-5-7-18-8-6-17/h1-2,9,16H,3-8,10H2 |
| InChIKey | RAWLTSIBNFIXSS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|