C9H11F2NS — CID 115223933
2-[(2,5-difluorophenyl)methylamino]ethanethiol (PubChem CID 115223933) has the molecular formula C9H11F2NS and a molecular weight of 203.26 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methylamino]ethanethiol.
| Compound Name | 2-[(2,5-difluorophenyl)methylamino]ethanethiol |
|---|---|
| PubChem CID | 115223933 |
| Molecular Formula | C9H11F2NS |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methylamino]ethanethiol |
| SMILES | Fc1ccc(F)c(CNCCS)c1 |
| InChI | InChI=1S/C9H11F2NS/c10-8-1-2-9(11)7(5-8)6-12-3-4-13/h1-2,5,12-13H,3-4,6H2 |
| InChIKey | WVLQHVORIOEULW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|