C8H9F2NO — CID 115228968
[(2,5-difluorophenyl)methylamino]methanol (PubChem CID 115228968) has the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. Its IUPAC name is [(2,5-difluorophenyl)methylamino]methanol.
| Compound Name | [(2,5-difluorophenyl)methylamino]methanol |
|---|---|
| PubChem CID | 115228968 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | [(2,5-difluorophenyl)methylamino]methanol |
| SMILES | OCNCc1cc(F)ccc1F |
| InChI | InChI=1S/C8H9F2NO/c9-7-1-2-8(10)6(3-7)4-11-5-12/h1-3,11-12H,4-5H2 |
| InChIKey | AVEZPUYGQKNDRE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|