C14H21F2NO — CID 103675866
1-[(2,5-difluorophenyl)methylamino]-4,4-dimethylpentan-2-ol (PubChem CID 103675866) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methylamino]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[(2,5-difluorophenyl)methylamino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 103675866 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methylamino]-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNCc1cc(F)ccc1F |
| InChI | InChI=1S/C14H21F2NO/c1-14(2,3)7-12(18)9-17-8-10-6-11(15)4-5-13(10)16/h4-6,12,17-18H,7-9H2,1-3H3 |
| InChIKey | MWIBLQWAFYKAOE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |