C14H20F2N2O2 — CID 63032651
1-[(2,5-difluorophenyl)methylamino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 63032651) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methylamino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[(2,5-difluorophenyl)methylamino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 63032651 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methylamino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | OC(CNCc1cc(F)ccc1F)CN1CCOCC1 |
| InChI | InChI=1S/C14H20F2N2O2/c15-12-1-2-14(16)11(7-12)8-17-9-13(19)10-18-3-5-20-6-4-18/h1-2,7,13,17,19H,3-6,8-10H2 |
| InChIKey | RFLFLVBYSRORNC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |