C18H23FN2O3 — CID 8024988
(2R)-1-[[5-(2-fluorophenyl)furan-2-yl]methylamino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 8024988) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is (2R)-1-[[5-(2-fluorophenyl)furan-2-yl]methylamino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2R)-1-[[5-(2-fluorophenyl)furan-2-yl]methylamino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 8024988 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (2R)-1-[[5-(2-fluorophenyl)furan-2-yl]methylamino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | O[C@H](CNCc1ccc(-c2ccccc2F)o1)CN1CCOCC1 |
| InChI | InChI=1S/C18H23FN2O3/c19-17-4-2-1-3-16(17)18-6-5-15(24-18)12-20-11-14(22)13-21-7-9-23-10-8-21/h1-6,14,20,22H,7-13H2/t14-/m1/s1 |
| InChIKey | RZFJRQHDFSTMMI-CQSZACIVSA-N |
| XLogP | 1.87 |
| TPSA | 57.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |