C21H28FN3O2 — CID 52506587
1-[[5-(2-fluorophenyl)furan-2-yl]methyl]-3-[(2R)-2-methyl-3-piperidin-1-ylpropyl]urea (PubChem CID 52506587) has the molecular formula C21H28FN3O2 and a molecular weight of 373.47 g/mol. Its IUPAC name is 1-[[5-(2-fluorophenyl)furan-2-yl]methyl]-3-[(2R)-2-methyl-3-piperidin-1-ylpropyl]urea.
| Compound Name | 1-[[5-(2-fluorophenyl)furan-2-yl]methyl]-3-[(2R)-2-methyl-3-piperidin-1-ylpropyl]urea |
|---|---|
| PubChem CID | 52506587 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 1-[[5-(2-fluorophenyl)furan-2-yl]methyl]-3-[(2R)-2-methyl-3-piperidin-1-ylpropyl]urea |
| SMILES | C[C@H](CNC(=O)NCc1ccc(-c2ccccc2F)o1)CN1CCCCC1 |
| InChI | InChI=1S/C21H28FN3O2/c1-16(15-25-11-5-2-6-12-25)13-23-21(26)24-14-17-9-10-20(27-17)18-7-3-4-8-19(18)22/h3-4,7-10,16H,2,5-6,11-15H2,1H3,(H2,23,24,26)/t16-/m1/s1 |
| InChIKey | YLICWXUAKXZYHL-MRXNPFEDSA-N |
| XLogP | 4.01 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |