C18H27BrFN3O — CID 52503139
1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-[(2S)-2-methyl-3-piperidin-1-ylpropyl]urea (PubChem CID 52503139) has the molecular formula C18H27BrFN3O and a molecular weight of 400.34 g/mol. Its IUPAC name is 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-[(2S)-2-methyl-3-piperidin-1-ylpropyl]urea.
| Compound Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-[(2S)-2-methyl-3-piperidin-1-ylpropyl]urea |
|---|---|
| PubChem CID | 52503139 |
| Molecular Formula | C18H27BrFN3O |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-[(2S)-2-methyl-3-piperidin-1-ylpropyl]urea |
| SMILES | C[C@@H](CNC(=O)NCCc1cc(Br)ccc1F)CN1CCCCC1 |
| InChI | InChI=1S/C18H27BrFN3O/c1-14(13-23-9-3-2-4-10-23)12-22-18(24)21-8-7-15-11-16(19)5-6-17(15)20/h5-6,11,14H,2-4,7-10,12-13H2,1H3,(H2,21,22,24)/t14-/m0/s1 |
| InChIKey | OZIKKDCKOMAMSA-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |