C17H24BrFN4O — CID 111928709
1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111928709) has the molecular formula C17H24BrFN4O and a molecular weight of 399.31 g/mol. Its IUPAC name is 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111928709 |
| Molecular Formula | C17H24BrFN4O |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(=O)N1CCCC1)NCCc1cc(Br)ccc1F |
| InChI | InChI=1S/C17H24BrFN4O/c1-2-20-17(22-12-16(24)23-9-3-4-10-23)21-8-7-13-11-14(18)5-6-15(13)19/h5-6,11H,2-4,7-10,12H2,1H3,(H2,20,21,22) |
| InChIKey | GUBMFCXBYHNVEW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|