C14H18BrF4N3 — CID 109474595
1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109474595) has the molecular formula C14H18BrF4N3 and a molecular weight of 384.22 g/mol. Its IUPAC name is 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109474595 |
| Molecular Formula | C14H18BrF4N3 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-ethyl-2-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCc1cc(Br)ccc1F |
| InChI | InChI=1S/C14H18BrF4N3/c1-2-20-13(22-8-6-14(17,18)19)21-7-5-10-9-11(15)3-4-12(10)16/h3-4,9H,2,5-8H2,1H3,(H2,20,21,22) |
| InChIKey | MBOZUYRMGWGZRW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|