C16H22F4N4O — CID 109471799
N-[2-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide (PubChem CID 109471799) has the molecular formula C16H22F4N4O and a molecular weight of 362.37 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 109471799 |
| Molecular Formula | C16H22F4N4O |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H22F4N4O/c1-2-21-15(23-8-7-16(18,19)20)24-10-9-22-14(25)11-12-3-5-13(17)6-4-12/h3-6H,2,7-11H2,1H3,(H,22,25)(H2,21,23,24) |
| InChIKey | VRPUPYHVTQBHTO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|