C16H24FIN4O — CID 136925711
N-[2-[[ethylamino-(prop-2-enylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 136925711) has the molecular formula C16H24FIN4O and a molecular weight of 434.30 g/mol. Its IUPAC name is N-[2-[[ethylamino-(prop-2-enylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-(prop-2-enylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 136925711 |
| Molecular Formula | C16H24FIN4O |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-[2-[[ethylamino-(prop-2-enylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | C=CCN/C(=N/CCNC(=O)Cc1ccc(F)cc1)NCC.I |
| InChI | InChI=1S/C16H23FN4O.HI/c1-3-9-20-16(18-4-2)21-11-10-19-15(22)12-13-5-7-14(17)8-6-13;/h3,5-8H,1,4,9-12H2,2H3,(H,19,22)(H2,18,20,21);1H |
| InChIKey | SGCCREXOMLNHDF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|