C10H21IN4O — CID 136925839
N-[2-[[ethylamino-(prop-2-enylamino)methylidene]amino]ethyl]acetamide;hydroiodide (PubChem CID 136925839) has the molecular formula C10H21IN4O and a molecular weight of 340.21 g/mol. Its IUPAC name is N-[2-[[ethylamino-(prop-2-enylamino)methylidene]amino]ethyl]acetamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-(prop-2-enylamino)methylidene]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 136925839 |
| Molecular Formula | C10H21IN4O |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-[2-[[ethylamino-(prop-2-enylamino)methylidene]amino]ethyl]acetamide;hydroiodide |
| SMILES | C=CCN/C(=N/CCNC(C)=O)NCC.I |
| InChI | InChI=1S/C10H20N4O.HI/c1-4-6-13-10(11-5-2)14-8-7-12-9(3)15;/h4H,1,5-8H2,2-3H3,(H,12,15)(H2,11,13,14);1H |
| InChIKey | KYWLCHAZOFFNDH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|