C18H34IN5O — CID 136926212
2-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide (PubChem CID 136926212) has the molecular formula C18H34IN5O and a molecular weight of 463.41 g/mol. Its IUPAC name is 2-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 136926212 |
| Molecular Formula | C18H34IN5O |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 2-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N/CCN1CCN(C(=O)C2CCCC2)CC1)NCC.I |
| InChI | InChI=1S/C18H33N5O.HI/c1-3-9-20-18(19-4-2)21-10-11-22-12-14-23(15-13-22)17(24)16-7-5-6-8-16;/h3,16H,1,4-15H2,2H3,(H2,19,20,21);1H |
| InChIKey | QLMBIIACUXADEF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|