C14H29N5 — CID 136926048
1-ethyl-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-prop-2-enylguanidine (PubChem CID 136926048) has the molecular formula C14H29N5 and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-prop-2-enylguanidine.
| Compound Name | 1-ethyl-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 136926048 |
| Molecular Formula | C14H29N5 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.24 |
| IUPAC Name | 1-ethyl-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N/CCN1CCCN(C)CC1)NCC |
| InChI | InChI=1S/C14H29N5/c1-4-7-16-14(15-5-2)17-8-11-19-10-6-9-18(3)12-13-19/h4H,1,5-13H2,2-3H3,(H2,15,16,17) |
| InChIKey | SBLXAYDAWGNESX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|