C17H36IN5S — CID 111530736
1-ethyl-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111530736) has the molecular formula C17H36IN5S and a molecular weight of 469.48 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111530736 |
| Molecular Formula | C17H36IN5S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 1-ethyl-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCCN(C)CC1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C17H35N5S.HI/c1-4-18-17(20-15-6-7-16(14-15)23-3)19-8-11-22-10-5-9-21(2)12-13-22;/h15-16H,4-14H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | LXBOVSUBUCXQOE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|