C12H25N3O2S2 — CID 111529771
1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-(2-methylsulfonylethyl)guanidine (PubChem CID 111529771) has the molecular formula C12H25N3O2S2 and a molecular weight of 307.49 g/mol. Its IUPAC name is 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-(2-methylsulfonylethyl)guanidine.
| Compound Name | 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-(2-methylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111529771 |
| Molecular Formula | C12H25N3O2S2 |
| Molecular Weight | 307.49 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-(2-methylsulfonylethyl)guanidine |
| SMILES | CCN/C(=N\CCS(C)(=O)=O)NC1CCC(SC)C1 |
| InChI | InChI=1S/C12H25N3O2S2/c1-4-13-12(14-7-8-19(3,16)17)15-10-5-6-11(9-10)18-2/h10-11H,4-9H2,1-3H3,(H2,13,14,15) |
| InChIKey | SZMVBSGUTRDLMV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|