C15H33IN4O2S2 — CID 111530430
1-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111530430) has the molecular formula C15H33IN4O2S2 and a molecular weight of 492.49 g/mol. Its IUPAC name is 1-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111530430 |
| Molecular Formula | C15H33IN4O2S2 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 1-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN(CC)S(C)(=O)=O)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C15H32N4O2S2.HI/c1-5-16-15(18-13-8-9-14(12-13)22-3)17-10-7-11-19(6-2)23(4,20)21;/h13-14H,5-12H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | YHFNHFSBMORBEB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|