C17H28IN3O2S2 — CID 111530706
2-[2-(benzenesulfonyl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111530706) has the molecular formula C17H28IN3O2S2 and a molecular weight of 497.47 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(benzenesulfonyl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111530706 |
| Molecular Formula | C17H28IN3O2S2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)c1ccccc1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C17H27N3O2S2.HI/c1-3-18-17(20-14-9-10-15(13-14)23-2)19-11-12-24(21,22)16-7-5-4-6-8-16;/h4-8,14-15H,3,9-13H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | KCAFWLONLSULDB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|