C21H35IN4O2S2 — CID 111529074
1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111529074) has the molecular formula C21H35IN4O2S2 and a molecular weight of 566.58 g/mol. Its IUPAC name is 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111529074 |
| Molecular Formula | C21H35IN4O2S2 |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(S(=O)(=O)N2CCCCC2)c1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C21H34N4O2S2.HI/c1-3-22-21(24-18-10-11-19(15-18)28-2)23-16-17-8-7-9-20(14-17)29(26,27)25-12-5-4-6-13-25;/h7-9,14,18-19H,3-6,10-13,15-16H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | SJVHIXKGGQSPKR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|