C21H33IN4OS — CID 111527982
N-[3-[[[ethylamino-[(3-methylsulfanylcyclopentyl)amino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide (PubChem CID 111527982) has the molecular formula C21H33IN4OS and a molecular weight of 516.49 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(3-methylsulfanylcyclopentyl)amino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[(3-methylsulfanylcyclopentyl)amino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111527982 |
| Molecular Formula | C21H33IN4OS |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | N-[3-[[[ethylamino-[(3-methylsulfanylcyclopentyl)amino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCC2)c1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C21H32N4OS.HI/c1-3-22-21(25-18-10-11-19(13-18)27-2)23-14-15-6-4-9-17(12-15)24-20(26)16-7-5-8-16;/h4,6,9,12,16,18-19H,3,5,7-8,10-11,13-14H2,1-2H3,(H,24,26)(H2,22,23,25);1H |
| InChIKey | HUWAUXKHCZNILY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|