C24H40IN5O — CID 111019888
N-[3-[[[ethylamino-[(1-propylpiperidin-4-yl)amino]methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide (PubChem CID 111019888) has the molecular formula C24H40IN5O and a molecular weight of 541.52 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(1-propylpiperidin-4-yl)amino]methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[(1-propylpiperidin-4-yl)amino]methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111019888 |
| Molecular Formula | C24H40IN5O |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | N-[3-[[[ethylamino-[(1-propylpiperidin-4-yl)amino]methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/Cc2cccc(NC(=O)C3CCCC3)c2)NCC)CC1.I |
| InChI | InChI=1S/C24H39N5O.HI/c1-3-14-29-15-12-21(13-16-29)28-24(25-4-2)26-18-19-8-7-11-22(17-19)27-23(30)20-9-5-6-10-20;/h7-8,11,17,20-21H,3-6,9-10,12-16,18H2,1-2H3,(H,27,30)(H2,25,26,28);1H |
| InChIKey | GQMPJSWUSDBSGM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|