C26H35N5O — CID 111924349
N-[3-[[[ethylamino-[[1-(4-methylphenyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 111924349) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[[1-(4-methylphenyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[[ethylamino-[[1-(4-methylphenyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 111924349 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | N-[3-[[[ethylamino-[[1-(4-methylphenyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCC2)c1)NC1CCN(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C26H35N5O/c1-3-27-26(30-23-14-15-31(18-23)24-12-10-19(2)11-13-24)28-17-20-6-4-9-22(16-20)29-25(32)21-7-5-8-21/h4,6,9-13,16,21,23H,3,5,7-8,14-15,17-18H2,1-2H3,(H,29,32)(H2,27,28,30) |
| InChIKey | SHCLUUDWNGPSOX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|