C19H33IN4O2S3 — CID 111528400
1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111528400) has the molecular formula C19H33IN4O2S3 and a molecular weight of 572.60 g/mol. Its IUPAC name is 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111528400 |
| Molecular Formula | C19H33IN4O2S3 |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N2CCCCC2)s1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C19H32N4O2S3.HI/c1-3-20-19(22-15-7-8-16(13-15)26-2)21-14-17-9-10-18(27-17)28(24,25)23-11-5-4-6-12-23;/h9-10,15-16H,3-8,11-14H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | PQTDKUGHIRAFRD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|