C18H32N4O2S2 — CID 111128601
1-ethyl-3-pentyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine (PubChem CID 111128601) has the molecular formula C18H32N4O2S2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 1-ethyl-3-pentyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-pentyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111128601 |
| Molecular Formula | C18H32N4O2S2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-ethyl-3-pentyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine |
| SMILES | CCCCCN/C(=N/Cc1ccc(S(=O)(=O)N2CCCCC2)s1)NCC |
| InChI | InChI=1S/C18H32N4O2S2/c1-3-5-7-12-20-18(19-4-2)21-15-16-10-11-17(25-16)26(23,24)22-13-8-6-9-14-22/h10-11H,3-9,12-15H2,1-2H3,(H2,19,20,21) |
| InChIKey | ZTSLOWUVTWRXEO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|