C17H31IN4O2S2 — CID 110944017
1-butan-2-yl-3-ethyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 110944017) has the molecular formula C17H31IN4O2S2 and a molecular weight of 514.50 g/mol. Its IUPAC name is 1-butan-2-yl-3-ethyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-3-ethyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110944017 |
| Molecular Formula | C17H31IN4O2S2 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 1-butan-2-yl-3-ethyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N2CCCCC2)s1)NC(C)CC.I |
| InChI | InChI=1S/C17H30N4O2S2.HI/c1-4-14(3)20-17(18-5-2)19-13-15-9-10-16(24-15)25(22,23)21-11-7-6-8-12-21;/h9-10,14H,4-8,11-13H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | FKFTUPZHEVQZJI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|