C21H31IN4O2S2 — CID 111900278
1-ethyl-2-[(3-methylphenyl)methyl]-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111900278) has the molecular formula C21H31IN4O2S2 and a molecular weight of 562.54 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methylphenyl)methyl]-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-methylphenyl)methyl]-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111900278 |
| Molecular Formula | C21H31IN4O2S2 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | 1-ethyl-2-[(3-methylphenyl)methyl]-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C)c1)NCc1ccc(S(=O)(=O)N2CCCCC2)s1.I |
| InChI | InChI=1S/C21H30N4O2S2.HI/c1-3-22-21(23-15-18-9-7-8-17(2)14-18)24-16-19-10-11-20(28-19)29(26,27)25-12-5-4-6-13-25;/h7-11,14H,3-6,12-13,15-16H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | GHEQNPAPUUECCO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|