C20H28N4O2S2 — CID 111038621
2-benzyl-1,1-dimethyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine (PubChem CID 111038621) has the molecular formula C20H28N4O2S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine.
| Compound Name | 2-benzyl-1,1-dimethyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111038621 |
| Molecular Formula | C20H28N4O2S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-benzyl-1,1-dimethyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCc1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C20H28N4O2S2/c1-23(2)20(21-15-17-9-5-3-6-10-17)22-16-18-11-12-19(27-18)28(25,26)24-13-7-4-8-14-24/h3,5-6,9-12H,4,7-8,13-16H2,1-2H3,(H,21,22) |
| InChIKey | VXQDRBFIAUUEAW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|