C16H26N4O4S2 — CID 36973453
2-methyl-N-[2-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methylcarbamoylamino]ethyl]propanamide (PubChem CID 36973453) has the molecular formula C16H26N4O4S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-methyl-N-[2-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methylcarbamoylamino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methylcarbamoylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 36973453 |
| Molecular Formula | C16H26N4O4S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-methyl-N-[2-[(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)methylcarbamoylamino]ethyl]propanamide |
| SMILES | CC(C)C(=O)NCCNC(=O)NCc1ccc(S(=O)(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C16H26N4O4S2/c1-12(2)15(21)17-7-8-18-16(22)19-11-13-5-6-14(25-13)26(23,24)20-9-3-4-10-20/h5-6,12H,3-4,7-11H2,1-2H3,(H,17,21)(H2,18,19,22) |
| InChIKey | USKHPKOSXZZOPN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|