C20H25ClN2O4S2 — CID 95086831
(2R)-N-[[5-(azepan-1-ylsulfonyl)thiophen-2-yl]methyl]-2-(3-chlorophenoxy)propanamide (PubChem CID 95086831) has the molecular formula C20H25ClN2O4S2 and a molecular weight of 457.02 g/mol. Its IUPAC name is (2R)-N-[[5-(azepan-1-ylsulfonyl)thiophen-2-yl]methyl]-2-(3-chlorophenoxy)propanamide.
| Compound Name | (2R)-N-[[5-(azepan-1-ylsulfonyl)thiophen-2-yl]methyl]-2-(3-chlorophenoxy)propanamide |
|---|---|
| PubChem CID | 95086831 |
| Molecular Formula | C20H25ClN2O4S2 |
| Molecular Weight | 457.02 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (2R)-N-[[5-(azepan-1-ylsulfonyl)thiophen-2-yl]methyl]-2-(3-chlorophenoxy)propanamide |
| SMILES | C[C@@H](Oc1cccc(Cl)c1)C(=O)NCc1ccc(S(=O)(=O)N2CCCCCC2)s1 |
| InChI | InChI=1S/C20H25ClN2O4S2/c1-15(27-17-8-6-7-16(21)13-17)20(24)22-14-18-9-10-19(28-18)29(25,26)23-11-4-2-3-5-12-23/h6-10,13,15H,2-5,11-12,14H2,1H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | VSLZPJIHOIVXDA-OAHLLOKOSA-N |
| XLogP | 4.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.02 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |