C21H25ClN2O5S — CID 26065788
(2S)-2-(3-chlorophenoxy)-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 26065788) has the molecular formula C21H25ClN2O5S and a molecular weight of 452.96 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenoxy)-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | (2S)-2-(3-chlorophenoxy)-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 26065788 |
| Molecular Formula | C21H25ClN2O5S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (2S)-2-(3-chlorophenoxy)-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)[C@H](C)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H25ClN2O5S/c1-15(29-17-8-6-7-16(22)13-17)21(25)23-19-14-18(9-10-20(19)28-2)30(26,27)24-11-4-3-5-12-24/h6-10,13-15H,3-5,11-12H2,1-2H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | DKTFADVSSZUJNA-HNNXBMFYSA-N |
| XLogP | 3.93 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |