C21H27N3O6S2 — CID 55343903
2-(4-ethoxyphenoxy)-N'-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]propanehydrazide (PubChem CID 55343903) has the molecular formula C21H27N3O6S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N'-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]propanehydrazide.
| Compound Name | 2-(4-ethoxyphenoxy)-N'-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 55343903 |
| Molecular Formula | C21H27N3O6S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N'-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]propanehydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)Cc2ccc(S(=O)(=O)N3CCCC3)s2)cc1 |
| InChI | InChI=1S/C21H27N3O6S2/c1-3-29-16-6-8-17(9-7-16)30-15(2)21(26)23-22-19(25)14-18-10-11-20(31-18)32(27,28)24-12-4-5-13-24/h6-11,15H,3-5,12-14H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | MICKROUMJGFMFB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|