C20H26N2O4S2 — CID 55599936
N-[[2-(ethoxymethyl)phenyl]methyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 55599936) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[[2-(ethoxymethyl)phenyl]methyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-[[2-(ethoxymethyl)phenyl]methyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 55599936 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[[2-(ethoxymethyl)phenyl]methyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | CCOCc1ccccc1CNC(=O)Cc1ccc(S(=O)(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C20H26N2O4S2/c1-2-26-15-17-8-4-3-7-16(17)14-21-19(23)13-18-9-10-20(27-18)28(24,25)22-11-5-6-12-22/h3-4,7-10H,2,5-6,11-15H2,1H3,(H,21,23) |
| InChIKey | ZQHLTUBETMRRHI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |