C14H23N3O3S2 — CID 119627872
N-(2-amino-2-methylpropyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 119627872) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-(2-amino-2-methylpropyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 119627872 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | CC(C)(N)CNC(=O)Cc1ccc(S(=O)(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C14H23N3O3S2/c1-14(2,15)10-16-12(18)9-11-5-6-13(21-11)22(19,20)17-7-3-4-8-17/h5-6H,3-4,7-10,15H2,1-2H3,(H,16,18) |
| InChIKey | XIKXPQRNJWFJTA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |