C16H24N2O5S2 — CID 119234105
5-[[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]pentanoic acid (PubChem CID 119234105) has the molecular formula C16H24N2O5S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 5-[[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]pentanoic acid.
| Compound Name | 5-[[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234105 |
| Molecular Formula | C16H24N2O5S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 5-[[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)Cc1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C16H24N2O5S2/c19-14(17-9-3-2-6-15(20)21)12-13-7-8-16(24-13)25(22,23)18-10-4-1-5-11-18/h7-8H,1-6,9-12H2,(H,17,19)(H,20,21) |
| InChIKey | PSDXSTGFPNHOEB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|