C19H30N2O5S2 — CID 46420163
methyl 7-[[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]heptanoate (PubChem CID 46420163) has the molecular formula C19H30N2O5S2 and a molecular weight of 430.59 g/mol. Its IUPAC name is methyl 7-[[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]heptanoate.
| Compound Name | methyl 7-[[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]heptanoate |
|---|---|
| PubChem CID | 46420163 |
| Molecular Formula | C19H30N2O5S2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | methyl 7-[[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]heptanoate |
| SMILES | COC(=O)CCCCCCNC(=O)Cc1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C19H30N2O5S2/c1-26-18(23)9-5-2-3-6-12-20-17(22)15-16-10-11-19(27-16)28(24,25)21-13-7-4-8-14-21/h10-11H,2-9,12-15H2,1H3,(H,20,22) |
| InChIKey | ZJMWBEGBIVICGF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|