C18H23N3O3S2 — CID 119548449
N-[2-(4-aminophenyl)ethyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 119548449) has the molecular formula C18H23N3O3S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 119548449 |
| Molecular Formula | C18H23N3O3S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | Nc1ccc(CCNC(=O)Cc2ccc(S(=O)(=O)N3CCCC3)s2)cc1 |
| InChI | InChI=1S/C18H23N3O3S2/c19-15-5-3-14(4-6-15)9-10-20-17(22)13-16-7-8-18(25-16)26(23,24)21-11-1-2-12-21/h3-8H,1-2,9-13,19H2,(H,20,22) |
| InChIKey | ZXJHPGKSLXJVGF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|