C15H26ClN3O3S2 — CID 119334238
4-amino-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]butanamide;hydrochloride (PubChem CID 119334238) has the molecular formula C15H26ClN3O3S2 and a molecular weight of 395.98 g/mol. Its IUPAC name is 4-amino-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119334238 |
| Molecular Formula | C15H26ClN3O3S2 |
| Molecular Weight | 395.98 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 4-amino-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]butanamide;hydrochloride |
| SMILES | Cl.NCCCC(=O)NCCc1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C15H25N3O3S2.ClH/c16-9-4-5-14(19)17-10-8-13-6-7-15(22-13)23(20,21)18-11-2-1-3-12-18;/h6-7H,1-5,8-12,16H2,(H,17,19);1H |
| InChIKey | KCHALWKQVKKFSD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.98 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |