C18H24ClN3O3S2 — CID 119945738
2-amino-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]benzamide;hydrochloride (PubChem CID 119945738) has the molecular formula C18H24ClN3O3S2 and a molecular weight of 430.00 g/mol. Its IUPAC name is 2-amino-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]benzamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119945738 |
| Molecular Formula | C18H24ClN3O3S2 |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-amino-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]benzamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1C(=O)NCCc1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C18H23N3O3S2.ClH/c19-16-7-3-2-6-15(16)18(22)20-11-10-14-8-9-17(25-14)26(23,24)21-12-4-1-5-13-21;/h2-3,6-9H,1,4-5,10-13,19H2,(H,20,22);1H |
| InChIKey | HDULUMRDXQFNRR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|