C16H28ClN3O3S2 — CID 119802226
4-(methylamino)-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]butanamide;hydrochloride (PubChem CID 119802226) has the molecular formula C16H28ClN3O3S2 and a molecular weight of 410.01 g/mol. Its IUPAC name is 4-(methylamino)-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]butanamide;hydrochloride.
| Compound Name | 4-(methylamino)-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119802226 |
| Molecular Formula | C16H28ClN3O3S2 |
| Molecular Weight | 410.01 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-(methylamino)-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NCCc1ccc(S(=O)(=O)N2CCCCC2)s1.Cl |
| InChI | InChI=1S/C16H27N3O3S2.ClH/c1-17-10-5-6-15(20)18-11-9-14-7-8-16(23-14)24(21,22)19-12-3-2-4-13-19;/h7-8,17H,2-6,9-13H2,1H3,(H,18,20);1H |
| InChIKey | SEBPPOXVYOTAPA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.01 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|