C16H27N3O4S2 — CID 119802253
2-(2-methoxyethylamino)-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]acetamide (PubChem CID 119802253) has the molecular formula C16H27N3O4S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]acetamide.
| Compound Name | 2-(2-methoxyethylamino)-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 119802253 |
| Molecular Formula | C16H27N3O4S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethyl]acetamide |
| SMILES | COCCNCC(=O)NCCc1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C16H27N3O4S2/c1-23-12-9-17-13-15(20)18-8-7-14-5-6-16(24-14)25(21,22)19-10-3-2-4-11-19/h5-6,17H,2-4,7-13H2,1H3,(H,18,20) |
| InChIKey | XXNCODXCKUXXNM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|